Online Database of Chemicals from Around the World
|
CAS#: 93882-22-5 Product: 2,2,8-Trimethylnonen-3-Ol No suppilers available for the product. |
| Name | 2,2,8-Trimethylnonen-3-Ol |
|---|---|
| Synonyms | 2,2,8-Trimethylnonen-3-Ol |
| Molecular Structure |  |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 |
| CAS Registry Number | 93882-22-5 |
| EINECS | 299-419-1 |
| SMILES | C(\C=C(C(C)(C)C)/O)CCC(C)C |
| InChI | 1S/C12H24O/c1-10(2)8-6-7-9-11(13)12(3,4)5/h9-10,13H,6-8H2,1-5H3/b11-9- |
| InChIKey | PKDBKVJGYKPROI-LUAWRHEFSA-N |
| Density | 0.846g/cm3 (Cal.) |
|---|---|
| Boiling point | 249.485°C at 760 mmHg (Cal.) |
| Flash point | 102.645°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,8-Trimethylnonen-3-Ol |