Online Database of Chemicals from Around the World
|
CAS#: 93892-38-7 Product: 1,1,3,3-Tetramethyl-6-(1-Phenylethyl)Indan-5-Ol No suppilers available for the product. |
| Name | 1,1,3,3-Tetramethyl-6-(1-Phenylethyl)Indan-5-Ol |
|---|---|
| Synonyms | 1,1,3,3-Tetramethyl-6-(1-Phenylethyl)Indan-5-Ol; 1,1,3,3-Tetramethyl-6-(1-Phenylethyl)-5-Indanol |
| Molecular Structure |  |
| Molecular Formula | C21H26O |
| Molecular Weight | 294.44 |
| CAS Registry Number | 93892-38-7 |
| EINECS | 299-521-6 |
| SMILES | C1=C(O)C(=CC2=C1C(CC2(C)C)(C)C)C(C3=CC=CC=C3)C |
| InChI | 1S/C21H26O/c1-14(15-9-7-6-8-10-15)16-11-17-18(12-19(16)22)21(4,5)13-20(17,2)3/h6-12,14,22H,13H2,1-5H3 |
| InChIKey | QEHZZXVKRGIJPX-UHFFFAOYSA-N |
| Density | 1.014g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.603°C at 760 mmHg (Cal.) |
| Flash point | 185.239°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,3,3-Tetramethyl-6-(1-Phenylethyl)Indan-5-Ol |