Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N2-Acetyl-N,N,N2,2-tetramethylalaninamide |
|---|---|
| Synonyms | N,N,2-trimethyl-2-(N-methylacetamido)propanamide |
| Molecular Structure |  |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 |
| CAS Registry Number | 939027-17-5 |
| SMILES | CC(=O)N(C)C(C)(C)C(=O)N(C)C |
| InChI | 1S/C9H18N2O2/c1-7(12)11(6)9(2,3)8(13)10(4)5/h1-6H3 |
| InChIKey | XYWONGDMCYSCTA-UHFFFAOYSA-N |
| Density | 1.002g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.339°C at 760 mmHg (Cal.) |
| Flash point | 116.549°C (Cal.) |
| Refractive index | 1.463 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N2-Acetyl-N,N,N2,2-tetramethylalaninamide |