|
CAS#: 93913-38-3 Product: Valylhistidylleucylthreonylproline No suppilers available for the product. |
| Name | Valylhistidylleucylthreonylproline |
|---|---|
| Synonyms | VAL-HIS-LEU-THR-PRO |
| Molecular Structure | ![]() |
| Molecular Formula | C26H43N7O7 |
| Molecular Weight | 565.66 |
| CAS Registry Number | 93913-38-3 |
| SMILES | OC(=O)C1CCCN1C(=O)C(NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(N)C(C)C)Cc2cncn2)C(C)O |
| InChI | 1S/C26H43N7O7/c1-13(2)9-17(23(36)32-21(15(5)34)25(38)33-8-6-7-19(33)26(39)40)30-22(35)18(10-16-11-28-12-29-16)31-24(37)20(27)14(3)4/h11-15,17-21,34H,6-10,27H2,1-5H3,(H,28,29)(H,30,35)(H,31,37)(H,32,36)(H,39,40) |
| InChIKey | BYCSDJAWFOZAFO-UHFFFAOYSA-N |
| Density | 1.282g/cm3 (Cal.) |
|---|---|
| Boiling point | 1003.153°C at 760 mmHg (Cal.) |
| Flash point | 560.487°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Valylhistidylleucylthreonylproline |