Online Database of Chemicals from Around the World
|
CAS#: 93940-26-2 Product: 3-Acetylphthalic Acid No suppilers available for the product. |
| Name | 3-Acetylphthalic Acid |
|---|---|
| Synonyms | 3-Ethanoylphthalic Acid; Acetylphthalic Acid |
| Molecular Structure |  |
| Molecular Formula | C10H8O5 |
| Molecular Weight | 208.17 |
| CAS Registry Number | 93940-26-2 |
| EINECS | 300-420-7 |
| SMILES | C1=CC=C(C(=O)C)C(=C1C(=O)O)C(=O)O |
| InChI | 1S/C10H8O5/c1-5(11)6-3-2-4-7(9(12)13)8(6)10(14)15/h2-4H,1H3,(H,12,13)(H,14,15) |
| InChIKey | QFNYIIZQJHOGII-UHFFFAOYSA-N |
| Density | 1.426g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.153°C at 760 mmHg (Cal.) |
| Flash point | 235.943°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Acetylphthalic Acid |