Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Acetyl(4-Fluorophenyl)]Acetic Acid |
|---|---|
| Synonyms | 2-(4-Fluorophenyl)-3-Oxo-Butanoic Acid; 2-(4-Fluorophenyl)-3-Keto-Butyric Acid; (Acetyl(4-Fluorophenyl))Acetic Acid |
| Molecular Structure | ![CAS#: 93962-54-0， Acetyl(4-Fluorophenyl)]Acetic Acid](/moreStructures/93962-54-0.gif) |
| Molecular Formula | C10H9FO3 |
| Molecular Weight | 196.18 |
| CAS Registry Number | 93962-54-0 |
| EINECS | 300-690-6 |
| SMILES | C1=C(C(C(C)=O)C(O)=O)C=CC(=C1)F |
| InChI | 1S/C10H9FO3/c1-6(12)9(10(13)14)7-2-4-8(11)5-3-7/h2-5,9H,1H3,(H,13,14) |
| InChIKey | RBHZLFQKJLXZRT-UHFFFAOYSA-N |
| Density | 1.291g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.624°C at 760 mmHg (Cal.) |
| Flash point | 138.032°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Acetyl(4-Fluorophenyl)]Acetic Acid |