Online Database of Chemicals from Around the World
|
CAS#: 93963-17-8 Product: 2,2'-(1,4-Piperazinediyldisulfanediyl)bis(1,3-benzothiazole) No suppilers available for the product. |
| Name | 2,2'-(1,4-Piperazinediyldisulfanediyl)bis(1,3-benzothiazole) |
|---|---|
| Synonyms | 2,2'-[piperazine-1,4-diylbis(thio)]bisbenzothiazole |
| Molecular Structure |  |
| Molecular Formula | C18H16N4S4 |
| Molecular Weight | 416.61 |
| CAS Registry Number | 93963-17-8 |
| EINECS | 300-758-5 |
| SMILES | c1cccc2sc(nc12)SN5CCN(Sc3nc4ccccc4s3)CC5 |
| InChI | 1S/C18H16N4S4/c1-3-7-15-13(5-1)19-17(23-15)25-21-9-11-22(12-10-21)26-18-20-14-6-2-4-8-16(14)24-18/h1-8H,9-12H2 |
| InChIKey | ZPRKIYGGPADCPK-UHFFFAOYSA-N |
| Density | 1.54g/cm3 (Cal.) |
|---|---|
| Boiling point | 610.772°C at 760 mmHg (Cal.) |
| Flash point | 323.183°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-(1,4-Piperazinediyldisulfanediyl)bis(1,3-benzothiazole) |