| Acesys Pharmatech | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (800) 792-0471 / (908) 998-1240 | |||
![]() |
info@acesyspharma.com, | |||
| Chemical manufacturer | ||||
| Berrchem Company Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (571) 8776-2660 | |||
![]() |
sales@berrchem.com | |||
| Chemical manufacturer since 2013 | ||||
| Fluorochem Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| PepTech Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (781) 273-5400 | |||
![]() |
service@peptechcorp.com | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | (3S,4R)-4-(3-Chlorophenyl)-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-pyrrolidinecarboxylic acid |
|---|---|
| Synonyms | Boc-(±)-t |
| Molecular Structure | ![]() |
| Molecular Formula | C16H20ClNO4 |
| Molecular Weight | 325.79 |
| CAS Registry Number | 939757-91-2 |
| SMILES | Clc1cccc(c1)[C@@H]2CN(C(=O)OC(C)(C)C)C[C@H]2C(=O)O |
| InChI | 1S/C16H20ClNO4/c1-16(2,3)22-15(21)18-8-12(13(9-18)14(19)20)10-5-4-6-11(17)7-10/h4-7,12-13H,8-9H2,1-3H3,(H,19,20)/t12-,13+/m0/s1 |
| InChIKey | JWDQWZPPUIYEEZ-QWHCGFSZSA-N |
| Density | 1.276g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.399°C at 760 mmHg (Cal.) |
| Flash point | 234.661°C (Cal.) |
| Refractive index | 1.558 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3S,4R)-4-(3-Chlorophenyl)-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-pyrrolidinecarboxylic acid |