Online Database of Chemicals from Around the World
|
CAS#: 939761-04-3 Product: Methyl 4'-(chlorosulfonyl)-4-biphenylcarboxylate No suppilers available for the product. |
| Name | Methyl 4'-(chlorosulfonyl)-4-biphenylcarboxylate |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C14H11ClO4S |
| Molecular Weight | 310.75 |
| CAS Registry Number | 939761-04-3 |
| SMILES | ClS(=O)(=O)c2ccc(c1ccc(C(=O)OC)cc1)cc2 |
| InChI | 1S/C14H11ClO4S/c1-19-14(16)12-4-2-10(3-5-12)11-6-8-13(9-7-11)20(15,17)18/h2-9H,1H3 |
| InChIKey | QDZFJHWZRKRETP-UHFFFAOYSA-N |
| Density | 1.355g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.58°C at 760 mmHg (Cal.) |
| Flash point | 220.86°C (Cal.) |
| Refractive index | 1.579 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4'-(chlorosulfonyl)-4-biphenylcarboxylate |