Online Database of Chemicals from Around the World
|
CAS#: 93981-81-8 Product: 4-Methyl-4-phenyl-2-pentanyl 2-methylpropanoate No suppilers available for the product. |
| Name | 4-Methyl-4-phenyl-2-pentanyl 2-methylpropanoate |
|---|---|
| Synonyms | 1,3-dimethyl-3-phenylbutyl isobutyrate |
| Molecular Structure |  |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.36 |
| CAS Registry Number | 93981-81-8 |
| EINECS | 301-169-6 |
| SMILES | CC(C)C(=O)OC(C)CC(C)(C)c1ccccc1 |
| InChI | 1S/C16H24O2/c1-12(2)15(17)18-13(3)11-16(4,5)14-9-7-6-8-10-14/h6-10,12-13H,11H2,1-5H3 |
| InChIKey | SEVWLTKTZSJZRJ-UHFFFAOYSA-N |
| Density | 0.957g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.794°C at 760 mmHg (Cal.) |
| Flash point | 106.558°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-4-phenyl-2-pentanyl 2-methylpropanoate |