Online Database of Chemicals from Around the World
|
CAS#: 93981-96-5 Product: Ethyl Hydroxy[(2-Methyl-1-Oxoallyl)Amino]Acetate No suppilers available for the product. |
| Name | Ethyl Hydroxy[(2-Methyl-1-Oxoallyl)Amino]Acetate |
|---|---|
| Synonyms | 2-Hydroxy-2-[(2-Methyl-1-Oxoprop-2-Enyl)Amino]Acetic Acid Ethyl Ester; 2-Hydroxy-2-Methacrylamido-Acetic Acid Ethyl Ester; Ethyl 2-Hydroxy-2-(2-Methylprop-2-Enoylamino)Ethanoate |
| Molecular Structure | ![CAS#: 93981-96-5， Ethyl Hydroxy[(2-Methyl-1-Oxoallyl)Amino]Acetate](/moreStructures/93981-96-5.gif) |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.20 |
| CAS Registry Number | 93981-96-5 |
| EINECS | 301-184-8 |
| SMILES | C(OC(=O)C(O)NC(=O)C(C)=C)C |
| InChI | 1S/C8H13NO4/c1-4-13-8(12)7(11)9-6(10)5(2)3/h7,11H,2,4H2,1,3H3,(H,9,10) |
| InChIKey | NOLVPZDOFTZBTP-UHFFFAOYSA-N |
| Density | 1.15g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.359°C at 760 mmHg (Cal.) |
| Flash point | 180.811°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl Hydroxy[(2-Methyl-1-Oxoallyl)Amino]Acetate |