Online Database of Chemicals from Around the World
| Asinex Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
 |
+7 (495) 780-3415 / 780-3417 | |||
 |
lsadovenko@asinex.com, | |||
| Chemical manufacturer | ||||
| Name | 1-(Salicylideneamino)guanidine |
|---|---|
| Synonyms | 2-[[(Z)-(6-Keto-1-Cyclohexa-2,4-Dienylidene)Methyl]Amino]Guanidine; Benzaldehyde, 2-Hydroxy-, (Aminoiminomethyl)Hydrazone; Guanidine, (Salicylideneamino)- |
| Molecular Structure |  |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 |
| CAS Registry Number | 94-90-6 |
| SMILES | O=C1\C(C=CC=C1)=C/NN=C(N)N |
| InChI | 1S/C8H10N4O/c9-8(10)12-11-5-6-3-1-2-4-7(6)13/h1-5,11H,(H4,9,10,12)/b6-5- |
| InChIKey | ZHBBGZOYDMQTNC-WAYWQWQTSA-N |
| Density | 1.339g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.693°C at 760 mmHg (Cal.) |
| Flash point | 182.222°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Salicylideneamino)guanidine |