Online Database of Chemicals from Around the World
|
CAS#: 94006-35-6 Product: 2,2,2-Trifluoro-N-(4-Mercaptophenyl)Acetamide No suppilers available for the product. |
| Name | 2,2,2-Trifluoro-N-(4-Mercaptophenyl)Acetamide |
|---|---|
| Synonyms | 2,2,2-Trifluoro-N-(4-Mercaptophenyl)Acetamide; 2,2,2-Trifluoro-N-(4-Sulfanylphenyl)Ethanamide |
| Molecular Structure |  |
| Molecular Formula | C8H6F3NOS |
| Molecular Weight | 221.20 |
| CAS Registry Number | 94006-35-6 |
| EINECS | 301-371-4 |
| SMILES | C1=CC(=CC=C1NC(C(F)(F)F)=O)S |
| InChI | 1S/C8H6F3NOS/c9-8(10,11)7(13)12-5-1-3-6(14)4-2-5/h1-4,14H,(H,12,13) |
| InChIKey | WJSDFLAFDAZHPZ-UHFFFAOYSA-N |
| Density | 1.46g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.774°C at 760 mmHg (Cal.) |
| Flash point | 138.727°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,2-Trifluoro-N-(4-Mercaptophenyl)Acetamide |