Online Database of Chemicals from Around the World
|
CAS#: 94021-45-1 Product: 5,5,7-Trimethylocta-3,7-Dien-2-One No suppilers available for the product. |
| Name | 5,5,7-Trimethylocta-3,7-Dien-2-One |
|---|---|
| Synonyms | 5,5,7-Trimethylocta-3,7-Dien-2-One |
| Molecular Structure |  |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 |
| CAS Registry Number | 94021-45-1 |
| EINECS | 301-440-9 |
| SMILES | C(C(\C=C\C(=O)C)(C)C)C(=C)C |
| InChI | 1S/C11H18O/c1-9(2)8-11(4,5)7-6-10(3)12/h6-7H,1,8H2,2-5H3/b7-6+ |
| InChIKey | UXHQEWRXRXZPBE-VOTSOKGWSA-N |
| Density | 0.849g/cm3 (Cal.) |
|---|---|
| Boiling point | 237.433°C at 760 mmHg (Cal.) |
| Flash point | 94.804°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5,7-Trimethylocta-3,7-Dien-2-One |