Online Database of Chemicals from Around the World
|
CAS#: 94021-86-0 Product: 1,4-Diamino-9,10-Dihydroanthracene-9,10-Diol No suppilers available for the product. |
| Name | 1,4-Diamino-9,10-Dihydroanthracene-9,10-Diol |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 |
| CAS Registry Number | 94021-86-0 |
| EINECS | 301-478-6 |
| SMILES | C1=CC(=C2C(=C1N)C(C3=C(C2O)C=CC=C3)O)N |
| InChI | 1S/C14H14N2O2/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-6,13-14,17-18H,15-16H2 |
| InChIKey | BRWUPFWYFPEOMA-UHFFFAOYSA-N |
| Density | 1.472g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.233°C at 760 mmHg (Cal.) |
| Flash point | 248.47°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Diamino-9,10-Dihydroanthracene-9,10-Diol |