Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,3-Dibromo-1,2,3,4-Tetrahydronaphthalene |
|---|---|
| Synonyms | 1,3-Dibromotetralin |
| Molecular Structure |  |
| Molecular Formula | C10H10Br2 |
| Molecular Weight | 290.00 |
| CAS Registry Number | 94070-85-6 |
| EINECS | 301-785-5 |
| SMILES | C1=CC=CC2=C1C(Br)CC(Br)C2 |
| InChI | 1S/C10H10Br2/c11-8-5-7-3-1-2-4-9(7)10(12)6-8/h1-4,8,10H,5-6H2 |
| InChIKey | VUDWWNGBDAJKFX-UHFFFAOYSA-N |
| Density | 1.758g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.122°C at 760 mmHg (Cal.) |
| Flash point | 166.588°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dibromo-1,2,3,4-Tetrahydronaphthalene |