Online Database of Chemicals from Around the World
|
CAS#: 94094-45-8 Product: 9H-Thioxanthene-3-carbonitrile 10,10-dioxide No suppilers available for the product. |
| Name | 9H-Thioxanthene-3-carbonitrile 10,10-dioxide |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C14H9NO2S |
| Molecular Weight | 255.29 |
| CAS Registry Number | 94094-45-8 |
| EINECS | 302-146-3 |
| SMILES | N#Cc2ccc3Cc1ccccc1S(=O)(=O)c3c2 |
| InChI | 1S/C14H9NO2S/c15-9-10-5-6-12-8-11-3-1-2-4-13(11)18(16,17)14(12)7-10/h1-7H,8H2 |
| InChIKey | CVJGTZDTLJIRCZ-UHFFFAOYSA-N |
| Density | 1.446g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.46°C at 760 mmHg (Cal.) |
| Flash point | 243.164°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9H-Thioxanthene-3-carbonitrile 10,10-dioxide |