Online Database of Chemicals from Around the World
|
CAS#: 94094-57-2 Product: 3-(Dimethylamino)-2'-Hydroxychalcone No suppilers available for the product. |
| Name | 3-(Dimethylamino)-2'-Hydroxychalcone |
|---|---|
| Synonyms | 3-(Dimethylamino)-2'-Hydroxychalcone |
| Molecular Structure |  |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 |
| CAS Registry Number | 94094-57-2 |
| EINECS | 302-159-4 |
| SMILES | C2=C(/C=C/C(=O)C1=C(O)C=CC=C1)C=CC=C2N(C)C |
| InChI | 1S/C17H17NO2/c1-18(2)14-7-5-6-13(12-14)10-11-17(20)15-8-3-4-9-16(15)19/h3-12,19H,1-2H3/b11-10+ |
| InChIKey | RNCIXUYJQAYRIM-ZHACJKMWSA-N |
| Density | 1.182g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.619°C at 760 mmHg (Cal.) |
| Flash point | 232.374°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Dimethylamino)-2'-Hydroxychalcone |