Online Database of Chemicals from Around the World
|
CAS#: 94105-87-0 Product: 6,7,4'-Trihydroxyisoflavanone No suppilers available for the product. |
| Name | 6,7,4'-Trihydroxyisoflavanone |
|---|---|
| Synonyms | 6,7-Dihydroxy-3-(4-Hydroxyphenyl)-4-Chromanone; 6,7,4'-Trihydroxyisoflavanone; 4H-1-Benzopyran-4-One, 2,3-Dihydro-6,7-Dihydroxy-3-(4-Hydroxyphenyl)- |
| Molecular Structure |  |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 |
| CAS Registry Number | 94105-87-0 |
| SMILES | C1=C(O)C(=CC3=C1C(=O)C(C2=CC=C(O)C=C2)CO3)O |
| InChI | 1S/C15H12O5/c16-9-3-1-8(2-4-9)11-7-20-14-6-13(18)12(17)5-10(14)15(11)19/h1-6,11,16-18H,7H2 |
| InChIKey | ZAIJTQZQMCNJHG-UHFFFAOYSA-N |
| Density | 1.485g/cm3 (Cal.) |
|---|---|
| Boiling point | 597.163°C at 760 mmHg (Cal.) |
| Flash point | 232.515°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7,4'-Trihydroxyisoflavanone |