Online Database of Chemicals from Around the World
|
CAS#: 94109-50-9 Product: Butyl 2,3-Dihydroxypropyl Sebacate No suppilers available for the product. |
| Name | Butyl 2,3-Dihydroxypropyl Sebacate |
|---|---|
| Synonyms | Decanedioic Acid Butyl Ester 2,3-Dihydroxypropyl Ester; Sebacic Acid Butyl Ester Glyceryl Ester; Butyl 2,3-Dihydroxypropyl Sebacate |
| Molecular Structure |  |
| Molecular Formula | C17H32O6 |
| Molecular Weight | 332.44 |
| CAS Registry Number | 94109-50-9 |
| EINECS | 302-492-5 |
| SMILES | C(OC(=O)CCCCCCCCC(OCCCC)=O)C(O)CO |
| InChI | 1S/C17H32O6/c1-2-3-12-22-16(20)10-8-6-4-5-7-9-11-17(21)23-14-15(19)13-18/h15,18-19H,2-14H2,1H3 |
| InChIKey | OFEWUYLHIHVRFQ-UHFFFAOYSA-N |
| Density | 1.067g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.158°C at 760 mmHg (Cal.) |
| Flash point | 138.072°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Butyl 2,3-Dihydroxypropyl Sebacate |