Online Database of Chemicals from Around the World
|
CAS#: 94129-60-9 Product: 7-(Hydroxyamino)-5,8-Quinolinedione No suppilers available for the product. |
| Name | 7-(Hydroxyamino)-5,8-Quinolinedione |
|---|---|
| Synonyms | 7-(Hydroxyamino)Quinoline-5,8-Quinone; 5,8-Quinolinedione, 7-(Hydroxyamino)-; 7-(Hydroxyamino)-5,8-Quinolinedione |
| Molecular Structure |  |
| Molecular Formula | C9H6N2O3 |
| Molecular Weight | 190.16 |
| CAS Registry Number | 94129-60-9 |
| SMILES | C1=CC=C2C(=N1)C(C(=CC2=O)NO)=O |
| InChI | 1S/C9H6N2O3/c12-7-4-6(11-14)9(13)8-5(7)2-1-3-10-8/h1-4,11,14H |
| InChIKey | XCKCFSDZJNCTRV-UHFFFAOYSA-N |
| Density | 1.556g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.939°C at 760 mmHg (Cal.) |
| Flash point | 205.353°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-(Hydroxyamino)-5,8-Quinolinedione |