|
CAS#: 94139-04-5 Product: (1-Bromocyclopentyl)-2-Thienyl Ketone No suppilers available for the product. |
| Name | (1-Bromocyclopentyl)-2-Thienyl Ketone |
|---|---|
| Synonyms | 3-(1-Bromocyclopentyl)-2-Thiophenecarboxaldehyde; (1-Bromocyclopentyl)-2-Thienyl Ketone |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11BrOS |
| Molecular Weight | 259.16 |
| CAS Registry Number | 94139-04-5 |
| EINECS | 303-019-5 |
| SMILES | C1=CSC(=C1C2(Br)CCCC2)C=O |
| InChI | 1S/C10H11BrOS/c11-10(4-1-2-5-10)8-3-6-13-9(8)7-12/h3,6-7H,1-2,4-5H2 |
| InChIKey | LSQDVMISJMOWGC-UHFFFAOYSA-N |
| Density | 1.553g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.586°C at 760 mmHg (Cal.) |
| Flash point | 165.829°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1-Bromocyclopentyl)-2-Thienyl Ketone |