Online Database of Chemicals from Around the World
|
CAS#: 94201-41-9 Product: [(1R,2R,3R)-1-[(1S)-1,2-dihydroxyethyl]-2,3,4-trihydroxy-butyl] 2-bromoacetate No suppilers available for the product. |
| Name | [(1R,2R,3R)-1-[(1S)-1,2-dihydroxyethyl]-2,3,4-trihydroxy-butyl] 2-bromoacetate |
|---|---|
| Synonyms | D-glucitol 3-(bromoacetate) |
| Molecular Structure | ![CAS#: 94201-41-9， [(1R,2R,3R)-1-[(1S)-1,2-dihydroxyethyl]-2,3,4-trihydroxy-butyl] 2-bromoacetate](/moreStructures/94201-41-9.gif) |
| Molecular Formula | C8H15BrO7 |
| Molecular Weight | 303.10 |
| CAS Registry Number | 94201-41-9 |
| EINECS | 303-627-0 |
| SMILES | O=C(O[C@@H]([C@H](O)[C@H](O)CO)[C@@H](O)CO)CBr |
| InChI | 1S/C8H15BrO7/c9-1-6(14)16-8(5(13)3-11)7(15)4(12)2-10/h4-5,7-8,10-13,15H,1-3H2/t4-,5+,7-,8-/m1/s1 |
| InChIKey | OSBOGWJBMWVGFO-IXROVEORSA-N |
| Density | 1.823g/cm3 (Cal.) |
|---|---|
| Boiling point | 573.24°C at 760 mmHg (Cal.) |
| Flash point | 300.485°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(1R,2R,3R)-1-[(1S)-1,2-dihydroxyethyl]-2,3,4-trihydroxy-butyl] 2-bromoacetate |