Online Database of Chemicals from Around the World
|
CAS#: 94201-51-1 Product: sodium 1-(1-cyclohexenyl)-5,5-diethyl-4,6-dioxo-pyrimidin-2-olate No suppilers available for the product. |
| Name | sodium 1-(1-cyclohexenyl)-5,5-diethyl-4,6-dioxo-pyrimidin-2-olate |
|---|---|
| Synonyms | sodium 1-(1-cyclohexen-1-yl)-5,5-diethylbarbiturate |
| Molecular Structure |  |
| Molecular Formula | C14H19N2NaO3 |
| Molecular Weight | 286.30 |
| CAS Registry Number | 94201-51-1 |
| EINECS | 303-638-0 |
| SMILES | [Na+].O=C2N(C1=CCCCC1)C([O-])=NC(=O)C2(CC)CC |
| InChI | 1S/C14H20N2O3.Na/c1-3-14(4-2)11(17)15-13(19)16(12(14)18)10-8-6-5-7-9-10;/h8H,3-7,9H2,1-2H3,(H,15,17,19);/q;+1/p-1 |
| InChIKey | FLWNXIIDIFHPFK-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for sodium 1-(1-cyclohexenyl)-5,5-diethyl-4,6-dioxo-pyrimidin-2-olate |