| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BoroChem | France | Inquire | ||
|---|---|---|---|---|
![]() |
+33 (2) 3194-5073 | |||
![]() |
info@borochem.fr | |||
| Chemical manufacturer | ||||
| Name | 5-Chloro-2'-fluoro-2,4'-bipyridine |
|---|---|
| Synonyms | [942206-11-3]; 5-Chloro-2'-fluoro-[2,4']bipyridine; 5-CHLORO-2'-FLUORO-[2,4']-BIPYRIDINE |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6ClFN2 |
| Molecular Weight | 208.62 |
| CAS Registry Number | 942206-11-3 |
| SMILES | C1=CC(=NC=C1Cl)C2=CC(=NC=C2)F |
| InChI | 1S/C10H6ClFN2/c11-8-1-2-9(14-6-8)7-3-4-13-10(12)5-7/h1-6H |
| InChIKey | UCTHNJGQZMBIOJ-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| 1.266-1.386 (Expl.) | |
| Boiling point | 309.5±37.0°C at 760 mmHg (Cal.) |
| Flash point | 141.0±26.5°C (Cal.) |
| Refractive index | 1.574 (Cal.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-2'-fluoro-2,4'-bipyridine |