| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| BoroChem | France | Inquire | ||
|---|---|---|---|---|
![]() |
+33 (2) 3194-5073 | |||
![]() |
info@borochem.fr | |||
| Chemical manufacturer | ||||
| Name | 6''-Chloro-3,2':5',3''-terpyridine |
|---|---|
| Synonyms | 6''-CHLORO-[3,2':5',3'']-TERPYRIDINE; 6'-CHLORO-3,2':5',3'-TERPYRIDINE; -Chloro-3,2':5',3 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10ClN3 |
| Molecular Weight | 267.71 |
| CAS Registry Number | 942206-13-5 |
| SMILES | C1=CC(=CN=C1)C2=NC=C(C=C2)C3=CN=C(C=C3)Cl |
| InChI | 1S/C15H10ClN3/c16-15-6-4-12(10-19-15)11-3-5-14(18-9-11)13-2-1-7-17-8-13/h1-10H |
| InChIKey | HFAGORVNAKFNGR-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| 1.205-1.325 (Expl.) | |
| Boiling point | 478.7±40.0°C at 760 mmHg (Cal.) |
| Flash point | 275.5±12.9°C (Cal.) |
| Refractive index | 1.623 (Cal.) |
| Safety Code | S26;S36/37 Details |
|---|---|
| Risk Code | R22;R36/37/38 Details |
| Hazard Symbol | X Details |
| Safety Description | WARNING: Irritates skin and eyes, harmful if swallowed |
| Market Analysis Reports |
| List of Reports Available for 6''-Chloro-3,2':5',3''-terpyridine |