Online Database of Chemicals from Around the World
|
CAS#: 94231-57-9 Product: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Henicosafluoroundecyl Acrylate No suppilers available for the product. |
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Henicosafluoroundecyl Acrylate |
|---|---|
| Synonyms | Prop-2-Enoic Acid 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Henicosafluoroundecyl Ester; Acrylic Acid 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Henicosafluoroundecyl Ester; 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Henicosafluoroundecyl Acryl |
| Molecular Structure |  |
| Molecular Formula | C14H5F21O2 |
| Molecular Weight | 604.16 |
| CAS Registry Number | 94231-57-9 |
| EINECS | 303-876-5 |
| SMILES | C(OC(=O)C=C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C14H5F21O2/c1-2-4(36)37-3-5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)11(27,28)12(29,30)13(31,32)14(33,34)35/h2H,1,3H2 |
| InChIKey | FPBNSCOPAZCJAV-UHFFFAOYSA-N |
| Density | 1.619g/cm3 (Cal.) |
|---|---|
| Boiling point | 249.401°C at 760 mmHg (Cal.) |
| Flash point | 101.624°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Henicosafluoroundecyl Acrylate |