Online Database of Chemicals from Around the World
|
CAS#: 94231-58-0 Product: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-Icosafluoro-11-(Vinyloxy)Undecane No suppilers available for the product. |
| Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-Icosafluoro-11-(Vinyloxy)Undecane |
|---|---|
| Synonyms | 11-Ethenoxy-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-Icosafluoro-Undecane; 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-Icosafluoroundecoxyethylene; 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-Icosafluoro-11-(Vinyloxy)Undecane |
| Molecular Structure |  |
| Molecular Formula | C13H6F20O |
| Molecular Weight | 558.16 |
| CAS Registry Number | 94231-58-0 |
| EINECS | 303-877-0 |
| SMILES | C(OC=C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | 1S/C13H6F20O/c1-2-34-3-5(16,17)7(20,21)9(24,25)11(28,29)13(32,33)12(30,31)10(26,27)8(22,23)6(18,19)4(14)15/h2,4H,1,3H2 |
| InChIKey | UBJGZTCVIFHNPM-UHFFFAOYSA-N |
| Density | 1.575g/cm3 (Cal.) |
|---|---|
| Boiling point | 238.052°C at 760 mmHg (Cal.) |
| Flash point | 104.724°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-Icosafluoro-11-(Vinyloxy)Undecane |