Online Database of Chemicals from Around the World
|
CAS#: 94237-17-9 Product: (dichloro-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silyl)oxy-trimethyl-silane No suppilers available for the product. |
| Name | (dichloro-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silyl)oxy-trimethyl-silane |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C11H13Cl2F13OSi2 |
| Molecular Weight | 535.28 |
| CAS Registry Number | 94237-17-9 |
| EINECS | 304-117-0 |
| SMILES | Cl[Si](Cl)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O[Si](C)(C)C |
| InChI | 1S/C11H13Cl2F13OSi2/c1-28(2,3)27-29(12,13)5-4-6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)26/h4-5H2,1-3H3 |
| InChIKey | KPVGLNAGKNDXKJ-UHFFFAOYSA-N |
| Density | 1.402g/cm3 (Cal.) |
|---|---|
| Boiling point | 250.905°C at 760 mmHg (Cal.) |
| Flash point | 105.544°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (dichloro-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silyl)oxy-trimethyl-silane |