Online Database of Chemicals from Around the World
|
CAS#: 94247-80-0 Product: tert-Butyl-4-Methylanisole No suppilers available for the product. |
| Name | tert-Butyl-4-Methylanisole |
|---|---|
| Synonyms | 2-Tert-Butyl-1-Methoxy-4-Methyl-Benzene; 2-Tert-Butyl-4-Methylanisole; Benzene, 2-(1,1-Dimethylethyl)-1-Methoxy-4-Methyl- |
| Molecular Structure |  |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 |
| CAS Registry Number | 94247-80-0 (43109-72-4) |
| EINECS | 304-250-4 |
| SMILES | C1=C(C=C(C(=C1)OC)C(C)(C)C)C |
| InChI | 1S/C12H18O/c1-9-6-7-11(13-5)10(8-9)12(2,3)4/h6-8H,1-5H3 |
| InChIKey | MFUCHEKLRHJSFE-UHFFFAOYSA-N |
| Density | 0.908g/cm3 (Cal.) |
|---|---|
| Boiling point | 244.013°C at 760 mmHg (Cal.) |
| Flash point | 86.061°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for tert-Butyl-4-Methylanisole |