Online Database of Chemicals from Around the World
|
CAS#: 94248-45-0 Product: Lithium 2,3-Dimethylnaphthalene-1-sulphonate No suppilers available for the product. |
| Name | Lithium 2,3-Dimethylnaphthalene-1-sulphonate |
|---|---|
| Synonyms | Lithium 2,3-Dimethyl-1-Naphthalenesulfonate; Lithium Dimethylnaphthalenesulphonate |
| Molecular Structure |  |
| Molecular Formula | C12H11LiO3S |
| Molecular Weight | 242.22 |
| CAS Registry Number | 94248-45-0 |
| EINECS | 304-317-8 |
| SMILES | C1=C(C(=C([S]([O-])(=O)=O)C2=C1C=CC=C2)C)C.[Li+] |
| InChI | 1S/C12H12O3S.Li/c1-8-7-10-5-3-4-6-11(10)12(9(8)2)16(13,14)15;/h3-7H,1-2H3,(H,13,14,15);/q;+1/p-1 |
| InChIKey | QFFCDLDNLKIGFL-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for Lithium 2,3-Dimethylnaphthalene-1-sulphonate |