Online Database of Chemicals from Around the World
|
CAS#: 94276-07-0 Product: 9-thia-6-azoniaspiro[5.5]undecane chloride No suppilers available for the product. |
| Name | 9-thia-6-azoniaspiro[5.5]undecane chloride |
|---|---|
| Molecular Structure | ![CAS#: 94276-07-0， 9-thia-6-azoniaspiro[5.5]undecane chloride](/moreStructures/94276-07-0.gif) |
| Molecular Formula | C9H18ClNS |
| Molecular Weight | 207.76 |
| CAS Registry Number | 94276-07-0 |
| EINECS | 304-496-2 |
| SMILES | [Cl-].C2CC[N+]1(CCSCC1)CC2 |
| InChI | 1S/C9H18NS.ClH/c1-2-4-10(5-3-1)6-8-11-9-7-10;/h1-9H2;1H/q+1;/p-1 |
| InChIKey | WXATUYAACRMMCO-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for 9-thia-6-azoniaspiro[5.5]undecane chloride |