Online Database of Chemicals from Around the World
|
CAS#: 94313-76-5 Product: 2-(2-butoxyethylamino)-1,4-dihydroxy-anthracene-9,10-dione No suppilers available for the product. |
| Name | 2-(2-butoxyethylamino)-1,4-dihydroxy-anthracene-9,10-dione |
|---|---|
| Synonyms | 2-[(2-butoxyethyl)amino]-1,4-dihydroxyanthraquinone |
| Molecular Structure |  |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.38 |
| CAS Registry Number | 94313-76-5 |
| EINECS | 304-975-6 |
| SMILES | O=C2c1ccccc1C(=O)c3c2c(O)cc(NCCOCCCC)c3O |
| InChI | 1S/C20H21NO5/c1-2-3-9-26-10-8-21-14-11-15(22)16-17(20(14)25)19(24)13-7-5-4-6-12(13)18(16)23/h4-7,11,21-22,25H,2-3,8-10H2,1H3 |
| InChIKey | RWOKTCVFQFPYSE-UHFFFAOYSA-N |
| Density | 1.345g/cm3 (Cal.) |
|---|---|
| Boiling point | 582.638°C at 760 mmHg (Cal.) |
| Flash point | 306.169°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-butoxyethylamino)-1,4-dihydroxy-anthracene-9,10-dione |