Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(Trifluoroacetyl)-2-piperidinone |
|---|---|
| Synonyms | 2-(dihydroxymethyl)-2,5-dihydrofuran-2,5-diol |
| Molecular Structure |  |
| Molecular Formula | C7H8F3NO2 |
| Molecular Weight | 195.14 |
| CAS Registry Number | 94363-58-3 |
| SMILES | C1CCN(C(=O)C1)C(=O)C(F)(F)F |
| InChI | 1S/C7H8F3NO2/c8-7(9,10)6(13)11-4-2-1-3-5(11)12/h1-4H2 |
| InChIKey | GEPLDFXBBIXQLL-UHFFFAOYSA-N |
| Density | 1.378g/cm3 (Cal.) |
|---|---|
| Boiling point | 205.586°C at 760 mmHg (Cal.) |
| Flash point | 78.136°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Trifluoroacetyl)-2-piperidinone |