Online Database of Chemicals from Around the World
|
CAS#: 944580-79-4 Product: N-Cyclobutyl-4-(trifluoromethyl)-2-pyridinamine No suppilers available for the product. |
| Name | N-Cyclobutyl-4-(trifluoromethyl)-2-pyridinamine |
|---|---|
| Synonyms | Cyclobutyl-(4-trifluoromethyl-pyridin-2-yl)-amine |
| Molecular Structure |  |
| Molecular Formula | C10H11F3N2 |
| Molecular Weight | 216.20 |
| CAS Registry Number | 944580-79-4 |
| SMILES | c1cnc(cc1C(F)(F)F)NC2CCC2 |
| InChI | 1S/C10H11F3N2/c11-10(12,13)7-4-5-14-9(6-7)15-8-2-1-3-8/h4-6,8H,1-3H2,(H,14,15) |
| InChIKey | RSDCFQUSPYJOHC-UHFFFAOYSA-N |
| Density | 1.329g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.073°C at 760 mmHg (Cal.) |
| Flash point | 129.836°C (Cal.) |
| Refractive index | 1.536 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Cyclobutyl-4-(trifluoromethyl)-2-pyridinamine |