|
CAS#: 945313-25-7 Product: 4-(2-Fluorobenzoyl)cyclohexanecarboxylic acid No suppilers available for the product. |
| Name | 4-(2-Fluorobenzoyl)cyclohexanecarboxylic acid |
|---|---|
| Synonyms | 4-[(2-fluorophenyl)carbonyl]cyclohexanecarboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15FO3 |
| Molecular Weight | 250.27 |
| CAS Registry Number | 945313-25-7 |
| SMILES | O=C(C1CCC(CC1)C(O)=O)c2ccccc2F |
| InChI | 1S/C14H15FO3/c15-12-4-2-1-3-11(12)13(16)9-5-7-10(8-6-9)14(17)18/h1-4,9-10H,5-8H2,(H,17,18) |
| InChIKey | IWCJCEZRMNYYKH-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.538°C at 760 mmHg (Cal.) |
| Flash point | 200.272°C (Cal.) |
| Refractive index | 1.547 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-(2-Fluorobenzoyl)cyclohexanecarboxylic acid |