|
CAS#: 945655-37-8 Product: Ethyl 6-amino-2-methyl-1H-indole-3-carboxylate No suppilers available for the product. |
| Name | Ethyl 6-amino-2-methyl-1H-indole-3-carboxylate |
|---|---|
| Synonyms | Ethyl6-amino-2-methyl-1H-indole-3-carboxylate |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.25 |
| CAS Registry Number | 945655-37-8 |
| SMILES | CCOC(=O)c1c([nH]c2c1ccc(c2)N)C |
| InChI | 1S/C12H14N2O2/c1-3-16-12(15)11-7(2)14-10-6-8(13)4-5-9(10)11/h4-6,14H,3,13H2,1-2H3 |
| InChIKey | NWBBCKJLJLKQNY-UHFFFAOYSA-N |
| Density | 1.248g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.478°C at 760 mmHg (Cal.) |
| Flash point | 206.284°C (Cal.) |
| Refractive index | 1.652 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 6-amino-2-methyl-1H-indole-3-carboxylate |