|
CAS#: 946496-56-6 Product: N-[4-(1-Aminocyclopropyl)-2-methoxyphenyl]methanesulfonamide No suppilers available for the product. |
| Name | N-[4-(1-Aminocyclopropyl)-2-methoxyphenyl]methanesulfonamide |
|---|---|
| Synonyms | Methanesu |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.32 |
| CAS Registry Number | 946496-56-6 |
| SMILES | COc1cc(ccc1NS(=O)(=O)C)C2(CC2)N |
| InChI | 1S/C11H16N2O3S/c1-16-10-7-8(11(12)5-6-11)3-4-9(10)13-17(2,14)15/h3-4,7,13H,5-6,12H2,1-2H3 |
| InChIKey | FTCOJUCUCXVWJV-UHFFFAOYSA-N |
| Density | 1.364g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.956°C at 760 mmHg (Cal.) |
| Flash point | 200.525°C (Cal.) |
| Refractive index | 1.616 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[4-(1-Aminocyclopropyl)-2-methoxyphenyl]methanesulfonamide |