|
CAS#: 947017-65-4 Product: 2-(2-Thienyl)-1H-pyrrolo[2,3-b]pyridine No suppilers available for the product. |
| Name | 2-(2-Thienyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| Synonyms | 1H-Pyrrolo[2,3-b]pyridine, 2-(2-thienyl)-; 1H-Pyrrolo[2,3-b]pyridine,2-(2-thienyl)-; 2-Thiophen-2-yl-1H-pyrrolo[2,3-b]pyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8N2S |
| Molecular Weight | 200.26 |
| CAS Registry Number | 947017-65-4 |
| SMILES | c1cc2cc([nH]c2nc1)c3cccs3 |
| InChI | 1S/C11H8N2S/c1-3-8-7-9(10-4-2-6-14-10)13-11(8)12-5-1/h1-7H,(H,12,13) |
| InChIKey | PGUOISVXUVNWFV-UHFFFAOYSA-N |
| Density | 1.336g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.884°C at 760 mmHg (Cal.) |
| Flash point | 201.747°C (Cal.) |
| Refractive index | 1.726 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Thienyl)-1H-pyrrolo[2,3-b]pyridine |