|
CAS#: 947534-36-3 Product: 5-Bromo-1,2-difluoro-3-(2,2,2-trifluoroethoxy)benzene No suppilers available for the product. |
| Name | 5-Bromo-1,2-difluoro-3-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| Synonyms | 5-Bromo-1,2-difluoro-3-(2,2,2-trifluoro-ethoxy)-benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C8H4BrF5O |
| Molecular Weight | 291.01 |
| CAS Registry Number | 947534-36-3 |
| SMILES | c1c(cc(c(c1OCC(F)(F)F)F)F)Br |
| InChI | 1S/C8H4BrF5O/c9-4-1-5(10)7(11)6(2-4)15-3-8(12,13)14/h1-2H,3H2 |
| InChIKey | MTBBOJFBRGIUHC-UHFFFAOYSA-N |
| Density | 1.702g/cm3 (Cal.) |
|---|---|
| Boiling point | 200.826°C at 760 mmHg (Cal.) |
| Flash point | 93.572°C (Cal.) |
| Refractive index | 1.447 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-Bromo-1,2-difluoro-3-(2,2,2-trifluoroethoxy)benzene |