Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-(3-Acetamido-4-methoxyphenyl)propanamide |
|---|---|
| Synonyms | N-(3-acetamido-4-methoxyphenyl)propionamide |
| Molecular Structure |  |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 |
| CAS Registry Number | 947968-84-5 |
| SMILES | CCC(=O)Nc1ccc(c(c1)NC(=O)C)OC |
| InChI | 1S/C12H16N2O3/c1-4-12(16)14-9-5-6-11(17-3)10(7-9)13-8(2)15/h5-7H,4H2,1-3H3,(H,13,15)(H,14,16) |
| InChIKey | BAQUKUYHTHTTSW-UHFFFAOYSA-N |
| Density | 1.205g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.784°C at 760 mmHg (Cal.) |
| Flash point | 237.312°C (Cal.) |
| Refractive index | 1.589 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3-Acetamido-4-methoxyphenyl)propanamide |