Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,4-Bis(Trichloromethyl)-6-Methyl-1,3,5-Triazine |
|---|---|
| Synonyms | 2-Methyl-4,6-Bis(Trichloromethyl)-S-Triazine; 1,3,5-Triazine, 2-Methyl-4,6-Bis(Trichloromethyl)- |
| Molecular Structure |  |
| Molecular Formula | C6H3Cl6N3 |
| Molecular Weight | 329.83 |
| CAS Registry Number | 949-42-8 |
| EINECS | 213-440-5 |
| SMILES | CC1=NC(=NC(=N1)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | 1S/C6H3Cl6N3/c1-2-13-3(5(7,8)9)15-4(14-2)6(10,11)12/h1H3 |
| InChIKey | LETDRANQSOEVCX-UHFFFAOYSA-N |
| Density | 1.754g/cm3 (Cal.) |
|---|---|
| Melting point | 96°C (Expl.) |
| Boiling point | 342.956°C at 760 mmHg (Cal.) |
| Flash point | 191.883°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,4-Bis(Trichloromethyl)-6-Methyl-1,3,5-Triazine |