|
CAS#: 95-39-6 Product: 5-Norbornene-2-methanol acrylate No suppilers available for the product. |
| Name | 5-Norbornene-2-methanol acrylate |
|---|---|
| Synonyms | Prop-2-Enoic Acid 6-Bicyclo[2.2.1]Hept-2-Enylmethyl Ester; Acrylic Acid 6-Bicyclo[2.2.1]Hept-2-Enylmethyl Ester; (Bicyclo(2.2.1)Hept-5-En-2-Yl)Methyl Acrylate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 |
| CAS Registry Number | 95-39-6 |
| EINECS | 202-415-4 |
| SMILES | C(C1C2CC(C1)C=C2)OC(C=C)=O |
| InChI | 1S/C11H14O2/c1-2-11(12)13-7-10-6-8-3-4-9(10)5-8/h2-4,8-10H,1,5-7H2 |
| InChIKey | IEOVKCGOIXZDRK-UHFFFAOYSA-N |
| Density | 1.063g/cm3 (Cal.) |
|---|---|
| Boiling point | 243.774°C at 760 mmHg (Cal.) |
| Flash point | 122.357°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Norbornene-2-methanol acrylate |