|
CAS#: 950603-16-4 Product: N-Methyl-1-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydro-2-naphthalenyl)methanamine No suppilers available for the product. |
| Name | N-Methyl-1-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydro-2-naphthalenyl)methanamine |
|---|---|
| Synonyms | methyl[(5 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 |
| CAS Registry Number | 950603-16-4 |
| SMILES | CC1(CCC(c2c1ccc(c2)CNC)(C)C)C |
| InChI | 1S/C16H25N/c1-15(2)8-9-16(3,4)14-10-12(11-17-5)6-7-13(14)15/h6-7,10,17H,8-9,11H2,1-5H3 |
| InChIKey | QBMLVHULRZTDKY-UHFFFAOYSA-N |
| Density | 0.908g/cm3 (Cal.) |
|---|---|
| Boiling point | 302.343°C at 760 mmHg (Cal.) |
| Flash point | 118.505°C (Cal.) |
| Refractive index | 1.499 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Methyl-1-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydro-2-naphthalenyl)methanamine |