Online Database of Chemicals from Around the World
|
CAS#: 951-39-3 Product: 3-Methoxydibenzofuran-2-amine No suppilers available for the product. |
| Name | 3-Methoxydibenzofuran-2-amine |
|---|---|
| Synonyms | 3-Methoxy-2-Dibenzofuranamine; (3-Methoxydibenzofuran-2-Yl)Amine; 2-Amino-3-Methoxydiphenylene Oxide |
| Molecular Structure |  |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 |
| CAS Registry Number | 951-39-3 |
| SMILES | C1=C(C(=CC2=C1C3=C(O2)C=CC=C3)OC)N |
| InChI | 1S/C13H11NO2/c1-15-13-7-12-9(6-10(13)14)8-4-2-3-5-11(8)16-12/h2-7H,14H2,1H3 |
| InChIKey | KYPCUWHXFBFCTI-UHFFFAOYSA-N |
| Density | 1.279g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.02°C at 760 mmHg (Cal.) |
| Flash point | 190.282°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methoxydibenzofuran-2-amine |