Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-[(2-Nitro-2-propanyl)sulfanyl]pyridine |
|---|---|
| Synonyms | 2-((2-nitropropan-2-yl)thio)pyridine |
| Molecular Structure | ![CAS#: 95106-85-7， 2-[(2-Nitro-2-propanyl)sulfanyl]pyridine](/moreStructures/95106-85-7.gif) |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.24 |
| CAS Registry Number | 95106-85-7 |
| SMILES | CC(C)([N+](=O)[O-])Sc1ccccn1 |
| InChI | 1S/C8H10N2O2S/c1-8(2,10(11)12)13-7-5-3-4-6-9-7/h3-6H,1-2H3 |
| InChIKey | AFIZLUQQBGNRLZ-UHFFFAOYSA-N |
| Density | 1.246g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.275°C at 760 mmHg (Cal.) |
| Flash point | 139.031°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(2-Nitro-2-propanyl)sulfanyl]pyridine |