Online Database of Chemicals from Around the World
|
CAS#: 952-16-9 Product: 5-Chloro-2-phenylbenzo[d]thiazole No suppilers available for the product. |
| Name | 5-Chloro-2-phenylbenzo[d]thiazole |
|---|---|
| Synonyms | Nsc402598 |
| Molecular Structure | ![CAS#: 952-16-9， 5-Chloro-2-phenylbenzo[d]thiazole](/moreStructures/952-16-9.gif) |
| Molecular Formula | C13H8ClNS |
| Molecular Weight | 245.73 |
| CAS Registry Number | 952-16-9 |
| SMILES | C1=CC(=CC2=C1SC(=N2)C3=CC=CC=C3)Cl |
| InChI | 1S/C13H8ClNS/c14-10-6-7-12-11(8-10)15-13(16-12)9-4-2-1-3-5-9/h1-8H |
| InChIKey | SVTDXKPYBJXBJR-UHFFFAOYSA-N |
| Density | 1.339g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.024°C at 760 mmHg (Cal.) |
| Flash point | 189.075°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-2-phenylbenzo[d]thiazole |