Online Database of Chemicals from Around the World
|
CAS#: 95397-29-8 Product: 1',2'-Dihydro-1'-6-Dihydroxyrotenone No suppilers available for the product. |
| Name | 1',2'-Dihydro-1'-6-Dihydroxyrotenone |
|---|---|
| Synonyms | Dh-1,6-Oh-Rotenone |
| Molecular Structure |  |
| Molecular Formula | C23H24O8 |
| Molecular Weight | 428.44 |
| CAS Registry Number | 95397-29-8 |
| SMILES | C1=C(C(=CC2=C1OCC5C2(C(C4=C(C3=C(OC(C3)C(CO)C)C=C4)O5)=O)O)OC)OC |
| InChI | 1S/C23H24O8/c1-11(9-24)16-6-13-15(30-16)5-4-12-21(13)31-20-10-29-17-8-19(28-3)18(27-2)7-14(17)23(20,26)22(12)25/h4-5,7-8,11,16,20,24,26H,6,9-10H2,1-3H3 |
| InChIKey | XTJUCYLBEQGXJE-UHFFFAOYSA-N |
| Density | 1.4g/cm3 (Cal.) |
|---|---|
| Boiling point | 665.434°C at 760 mmHg (Cal.) |
| Flash point | 233.228°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1',2'-Dihydro-1'-6-Dihydroxyrotenone |