| Crescent Chemical Co. Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 348-0333 | |||
![]() |
crescent@creschem.com | |||
| Chemical distributor | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Analytical chemistry >> Standard >> Pesticides, veterinary drugs and fertilizers |
|---|---|
| Name | N-(3,4-Dichlorophenyl)-N-propionylpropanamide |
| Synonyms | 3,4-Dichlorophenyldipropionamide; 45733_RIEDEL |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13Cl2NO2 |
| Molecular Weight | 274.14 |
| CAS Registry Number | 954-24-5 |
| SMILES | Clc1ccc(N(C(=O)CC)C(=O)CC)cc1Cl |
| InChI | 1S/C12H13Cl2NO2/c1-3-11(16)15(12(17)4-2)8-5-6-9(13)10(14)7-8/h5-7H,3-4H2,1-2H3 |
| InChIKey | ZDAFHQWFOMHDMG-UHFFFAOYSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.025°C at 760 mmHg (Cal.) |
| Flash point | 235.039°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3,4-Dichlorophenyl)-N-propionylpropanamide |