Online Database of Chemicals from Around the World
|
CAS#: 954240-66-5 Product: 2-[5-(Bromomethyl)-3-pyridinyl]-1H-isoindole-1,3(2H)-dione No suppilers available for the product. |
| Name | 2-[5-(Bromomethyl)-3-pyridinyl]-1H-isoindole-1,3(2H)-dione |
|---|---|
| Synonyms | 3-Bromomethyl-5-phthalimido-pyridine |
| Molecular Structure | ![CAS#: 954240-66-5， 2-[5-(Bromomethyl)-3-pyridinyl]-1H-isoindole-1,3(2H)-dione](/moreStructures/954240-66-5.gif) |
| Molecular Formula | C14H9BrN2O2 |
| Molecular Weight | 317.14 |
| CAS Registry Number | 954240-66-5 |
| SMILES | c1ccc2c(c1)C(=O)N(C2=O)c3cc(cnc3)CBr |
| InChI | 1S/C14H9BrN2O2/c15-6-9-5-10(8-16-7-9)17-13(18)11-3-1-2-4-12(11)14(17)19/h1-5,7-8H,6H2 |
| InChIKey | CURVTBUTMQTNFW-UHFFFAOYSA-N |
| Density | 1.674g/cm3 (Cal.) |
|---|---|
| Boiling point | 505.579°C at 760 mmHg (Cal.) |
| Flash point | 259.565°C (Cal.) |
| Refractive index | 1.695 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-[5-(Bromomethyl)-3-pyridinyl]-1H-isoindole-1,3(2H)-dione |